C11H12ClNO2 — CID 82473511
methyl 6-chloro-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 82473511) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is methyl 6-chloro-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | methyl 6-chloro-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 82473511 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | methyl 6-chloro-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)N1CCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H12ClNO2/c1-15-11(14)13-6-2-3-8-7-9(12)4-5-10(8)13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | JIKPMPMKSFQVOF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |