methyl 5-fluoro-2,3-dihydroindole-1-carboxylate

C10H10FNO2 — CID 110713972

IUPACmethyl 5-fluoro-2,3-dihydroindole-1-carboxylate
SMILESCOC(=O)N1CCc2cc(F)ccc21
InChIInChI=1S/C10H10FNO2/c1-14-10(13)12-5-4-7-6-8(11)2-3-9(7)12/h2-3,6H,4-5H2,1H3
InChIKeyNJYXHPWLXINBNK-UHFFFAOYSA-N
MW195.19 g/mol
LogP1.95
Rot. Bonds

About methyl 5-fluoro-2,3-dihydroindole-1-carboxylate

methyl 5-fluoro-2,3-dihydroindole-1-carboxylate (PubChem CID 110713972) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is methyl 5-fluoro-2,3-dihydroindole-1-carboxylate.

Molecular Properties

Compound Namemethyl 5-fluoro-2,3-dihydroindole-1-carboxylate
PubChem CID110713972
Molecular FormulaC10H10FNO2
Molecular Weight195.19 g/mol
Exact Mass195.07
IUPAC Namemethyl 5-fluoro-2,3-dihydroindole-1-carboxylate
SMILESCOC(=O)N1CCc2cc(F)ccc21
InChIInChI=1S/C10H10FNO2/c1-14-10(13)12-5-4-7-6-8(11)2-3-9(7)12/h2-3,6H,4-5H2,1H3
InChIKeyNJYXHPWLXINBNK-UHFFFAOYSA-N
XLogP1.95
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.19
LogP ≤ 51.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 5-fluoro-2,3-dihydroindole-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-fluoro-2,3-dihydroindole-1-carboxylate?
The IUPAC name of methyl 5-fluoro-2,3-dihydroindole-1-carboxylate (CID 110713972) is methyl 5-fluoro-2,3-dihydroindole-1-carboxylate.
What is the SMILES notation for methyl 5-fluoro-2,3-dihydroindole-1-carboxylate?
The canonical SMILES for methyl 5-fluoro-2,3-dihydroindole-1-carboxylate is COC(=O)N1CCc2cc(F)ccc21.
What is the InChIKey of methyl 5-fluoro-2,3-dihydroindole-1-carboxylate?
The InChIKey is NJYXHPWLXINBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO2/c1-14-10(13)12-5-4-7-6-8(11)2-3-9(7)12/h2-3,6H,4-5H2,1H3.
What are the key properties of methyl 5-fluoro-2,3-dihydroindole-1-carboxylate?
methyl 5-fluoro-2,3-dihydroindole-1-carboxylate has a molecular weight of 195.19 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-fluoro-2,3-dihydroindole-1-carboxylate is sourced from PubChem (CID 110713972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).