C16H13ClFNO4S — CID 26527276
(2-chloro-4-fluorophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate (PubChem CID 26527276) has the molecular formula C16H13ClFNO4S and a molecular weight of 369.80 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate.
| Compound Name | (2-chloro-4-fluorophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
|---|---|
| PubChem CID | 26527276 |
| Molecular Formula | C16H13ClFNO4S |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (2-chloro-4-fluorophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)Oc3ccc(F)cc3Cl)ccc21 |
| InChI | InChI=1S/C16H13ClFNO4S/c1-10(20)19-7-6-11-8-13(3-4-15(11)19)24(21,22)23-16-5-2-12(18)9-14(16)17/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | LEOMFDVQZDGLNF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|