C11H12N2O4S — CID 117038028
(1-acetyl-2,3-dihydroindol-5-yl)sulfonylformamide (PubChem CID 117038028) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is (1-acetyl-2,3-dihydroindol-5-yl)sulfonylformamide.
| Compound Name | (1-acetyl-2,3-dihydroindol-5-yl)sulfonylformamide |
|---|---|
| PubChem CID | 117038028 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (1-acetyl-2,3-dihydroindol-5-yl)sulfonylformamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)C(N)=O)ccc21 |
| InChI | InChI=1S/C11H12N2O4S/c1-7(14)13-5-4-8-6-9(2-3-10(8)13)18(16,17)11(12)15/h2-3,6H,4-5H2,1H3,(H2,12,15) |
| InChIKey | BACHITNGPBVULZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|