C10H13N3O3S — CID 43476939
1-acetyl-2,3-dihydroindole-5-sulfonohydrazide (PubChem CID 43476939) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 1-acetyl-2,3-dihydroindole-5-sulfonohydrazide.
| Compound Name | 1-acetyl-2,3-dihydroindole-5-sulfonohydrazide |
|---|---|
| PubChem CID | 43476939 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-acetyl-2,3-dihydroindole-5-sulfonohydrazide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)NN)ccc21 |
| InChI | InChI=1S/C10H13N3O3S/c1-7(14)13-5-4-8-6-9(2-3-10(8)13)17(15,16)12-11/h2-3,6,12H,4-5,11H2,1H3 |
| InChIKey | FPPOHKMYKGTIGW-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|