C12H15NO4S — CID 117036710
1-[5-(2-hydroxyethylsulfonyl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 117036710) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 1-[5-(2-hydroxyethylsulfonyl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-(2-hydroxyethylsulfonyl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 117036710 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 1-[5-(2-hydroxyethylsulfonyl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)CCO)ccc21 |
| InChI | InChI=1S/C12H15NO4S/c1-9(15)13-5-4-10-8-11(2-3-12(10)13)18(16,17)7-6-14/h2-3,8,14H,4-7H2,1H3 |
| InChIKey | MYJHXEQMFLLLCW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |