C13H17NO3S — CID 117031946
1-(6-ethylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 117031946) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-(6-ethylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 1-(6-ethylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 117031946 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(6-ethylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)CCCN2C(C)=O |
| InChI | InChI=1S/C13H17NO3S/c1-3-18(16,17)12-6-7-13-11(9-12)5-4-8-14(13)10(2)15/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | RFKSVBFJPUZWBQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |