C15H20N2O3S — CID 114616615
1-acetyl-N-(2-methylprop-2-enyl)-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 114616615) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-acetyl-N-(2-methylprop-2-enyl)-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-acetyl-N-(2-methylprop-2-enyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 114616615 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-acetyl-N-(2-methylprop-2-enyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | C=C(C)CNS(=O)(=O)c1ccc2c(c1)CCCN2C(C)=O |
| InChI | InChI=1S/C15H20N2O3S/c1-11(2)10-16-21(19,20)14-6-7-15-13(9-14)5-4-8-17(15)12(3)18/h6-7,9,16H,1,4-5,8,10H2,2-3H3 |
| InChIKey | SABZYYNOKJWDHP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|