C16H14Cl2N2O3S — CID 3164268
1-acetyl-N-(2,5-dichlorophenyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 3164268) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is 1-acetyl-N-(2,5-dichlorophenyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-(2,5-dichlorophenyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 3164268 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 1-acetyl-N-(2,5-dichlorophenyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)Nc3cc(Cl)ccc3Cl)ccc21 |
| InChI | InChI=1S/C16H14Cl2N2O3S/c1-10(21)20-7-6-11-8-13(3-5-16(11)20)24(22,23)19-15-9-12(17)2-4-14(15)18/h2-5,8-9,19H,6-7H2,1H3 |
| InChIKey | BXYHRQXBDOXTEE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |