C20H18N2O3S2 — CID 17469301
1-acetyl-N-(2-thiophen-2-ylphenyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 17469301) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-acetyl-N-(2-thiophen-2-ylphenyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-(2-thiophen-2-ylphenyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 17469301 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1-acetyl-N-(2-thiophen-2-ylphenyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)Nc3ccccc3-c3cccs3)ccc21 |
| InChI | InChI=1S/C20H18N2O3S2/c1-14(23)22-11-10-15-13-16(8-9-19(15)22)27(24,25)21-18-6-3-2-5-17(18)20-7-4-12-26-20/h2-9,12-13,21H,10-11H2,1H3 |
| InChIKey | FMOUTXAFUGXIIF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |