C18H19N3O4S — CID 40687880
N-[3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]phenyl]acetamide (PubChem CID 40687880) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]phenyl]acetamide.
| Compound Name | N-[3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 40687880 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NS(=O)(=O)c2ccc3c(c2)CCN3C(C)=O)c1 |
| InChI | InChI=1S/C18H19N3O4S/c1-12(22)19-15-4-3-5-16(11-15)20-26(24,25)17-6-7-18-14(10-17)8-9-21(18)13(2)23/h3-7,10-11,20H,8-9H2,1-2H3,(H,19,22) |
| InChIKey | HPYFNEBFFNYLSA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |