C24H25N3O5S2 — CID 24510126
1-acetyl-N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 24510126) has the molecular formula C24H25N3O5S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is 1-acetyl-N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 24510126 |
| Molecular Formula | C24H25N3O5S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 1-acetyl-N-[4-[benzyl(methyl)sulfamoyl]phenyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)Nc3ccc(S(=O)(=O)N(C)Cc4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C24H25N3O5S2/c1-18(28)27-15-14-20-16-23(12-13-24(20)27)33(29,30)25-21-8-10-22(11-9-21)34(31,32)26(2)17-19-6-4-3-5-7-19/h3-13,16,25H,14-15,17H2,1-2H3 |
| InChIKey | OVHSELDGLIEHIH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |