C24H24N2O3S — CID 52561459
1-acetyl-N-benzyl-N-(3-methylphenyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 52561459) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-acetyl-N-benzyl-N-(3-methylphenyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-benzyl-N-(3-methylphenyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 52561459 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-acetyl-N-benzyl-N-(3-methylphenyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)N(Cc3ccccc3)c3cccc(C)c3)ccc21 |
| InChI | InChI=1S/C24H24N2O3S/c1-18-7-6-10-22(15-18)26(17-20-8-4-3-5-9-20)30(28,29)23-11-12-24-21(16-23)13-14-25(24)19(2)27/h3-12,15-16H,13-14,17H2,1-2H3 |
| InChIKey | VFYFKNDLBISFAQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |