C20H22N2O5S — CID 6619736
4-[5-[benzyl(methyl)sulfamoyl]-2,3-dihydroindol-1-yl]-4-oxobutanoic acid (PubChem CID 6619736) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is 4-[5-[benzyl(methyl)sulfamoyl]-2,3-dihydroindol-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-[benzyl(methyl)sulfamoyl]-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6619736 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-[5-[benzyl(methyl)sulfamoyl]-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)CCC(=O)O |
| InChI | InChI=1S/C20H22N2O5S/c1-21(14-15-5-3-2-4-6-15)28(26,27)17-7-8-18-16(13-17)11-12-22(18)19(23)9-10-20(24)25/h2-8,13H,9-12,14H2,1H3,(H,24,25) |
| InChIKey | MRFPIYBDFNHLBO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |