C19H18N2O7S — CID 20864325
3-[[1-(3-carboxypropanoyl)-2,3-dihydroindol-5-yl]sulfonylamino]benzoic acid (PubChem CID 20864325) has the molecular formula C19H18N2O7S and a molecular weight of 418.43 g/mol. Its IUPAC name is 3-[[1-(3-carboxypropanoyl)-2,3-dihydroindol-5-yl]sulfonylamino]benzoic acid.
| Compound Name | 3-[[1-(3-carboxypropanoyl)-2,3-dihydroindol-5-yl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 20864325 |
| Molecular Formula | C19H18N2O7S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 3-[[1-(3-carboxypropanoyl)-2,3-dihydroindol-5-yl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)CCC(=O)N1CCc2cc(S(=O)(=O)Nc3cccc(C(=O)O)c3)ccc21 |
| InChI | InChI=1S/C19H18N2O7S/c22-17(6-7-18(23)24)21-9-8-12-11-15(4-5-16(12)21)29(27,28)20-14-3-1-2-13(10-14)19(25)26/h1-5,10-11,20H,6-9H2,(H,23,24)(H,25,26) |
| InChIKey | VDSSZTHPPKLWTK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |