C20H30N2O5S — CID 3243399
4-[5-(2-ethylhexylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid (PubChem CID 3243399) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[5-(2-ethylhexylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-(2-ethylhexylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3243399 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 4-[5-(2-ethylhexylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
| SMILES | CCCCC(CC)CNS(=O)(=O)c1ccc2c(c1)CCN2C(=O)CCC(=O)O |
| InChI | InChI=1S/C20H30N2O5S/c1-3-5-6-15(4-2)14-21-28(26,27)17-7-8-18-16(13-17)11-12-22(18)19(23)9-10-20(24)25/h7-8,13,15,21H,3-6,9-12,14H2,1-2H3,(H,24,25) |
| InChIKey | BPNFMHNNTXNKIN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |