C18H26N2O5S — CID 20858685
5-[5-(3-methylbutylsulfamoyl)-2,3-dihydroindol-1-yl]-5-oxopentanoic acid (PubChem CID 20858685) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is 5-[5-(3-methylbutylsulfamoyl)-2,3-dihydroindol-1-yl]-5-oxopentanoic acid.
| Compound Name | 5-[5-(3-methylbutylsulfamoyl)-2,3-dihydroindol-1-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 20858685 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5-[5-(3-methylbutylsulfamoyl)-2,3-dihydroindol-1-yl]-5-oxopentanoic acid |
| SMILES | CC(C)CCNS(=O)(=O)c1ccc2c(c1)CCN2C(=O)CCCC(=O)O |
| InChI | InChI=1S/C18H26N2O5S/c1-13(2)8-10-19-26(24,25)15-6-7-16-14(12-15)9-11-20(16)17(21)4-3-5-18(22)23/h6-7,12-13,19H,3-5,8-11H2,1-2H3,(H,22,23) |
| InChIKey | SJMHPUGUNQGMJW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |