C20H33N3O3S — CID 20851711
N-[3-(dipropylamino)propyl]-1-propanoyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 20851711) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is N-[3-(dipropylamino)propyl]-1-propanoyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[3-(dipropylamino)propyl]-1-propanoyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 20851711 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[3-(dipropylamino)propyl]-1-propanoyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCCN(CCC)CCCNS(=O)(=O)c1ccc2c(c1)CCN2C(=O)CC |
| InChI | InChI=1S/C20H33N3O3S/c1-4-12-22(13-5-2)14-7-11-21-27(25,26)18-8-9-19-17(16-18)10-15-23(19)20(24)6-3/h8-9,16,21H,4-7,10-15H2,1-3H3 |
| InChIKey | WBRBUPDRKRBMOU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|