About ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate
ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate (PubChem CID 155900837) has the molecular formula C21H30N4O6S
and a molecular weight of 466.56 g/mol. Its IUPAC name is ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate |
| PubChem CID | 155900837 |
| Molecular Formula | C21H30N4O6S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCNS(=O)(=O)c2ccc3c(c2)CCN3C(=O)CC)CC1 |
| InChI | InChI=1S/C21H30N4O6S/c1-3-19(26)25-10-8-16-15-17(5-6-18(16)25)32(29,30)22-9-7-20(27)23-11-13-24(14-12-23)21(28)31-4-2/h5-6,15,22H,3-4,7-14H2,1-2H3 |
| InChIKey | CIRPUOAUZXVHSE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate (CID 155900837) is ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C(=O)CCNS(=O)(=O)c2ccc3c(c2)CCN3C(=O)CC)CC1.
What is the InChIKey of ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate?
The InChIKey is CIRPUOAUZXVHSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4O6S/c1-3-19(26)25-10-8-16-15-17(5-6-18(16)25)32(29,30)22-9-7-20(27)23-11-13-24(14-12-23)21(28)31-4-2/h5-6,15,22H,3-4,7-14H2,1-2H3.
What are the key properties of ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate?
ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate has a molecular weight of 466.56 g/mol, XLogP of 0.95, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-[(1-propanoyl-2,3-dihydroindol-5-yl)sulfonylamino]propanoyl]piperazine-1-carboxylate is sourced from PubChem (CID 155900837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).