C16H23N3O4S — CID 112990704
2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-N-butylacetamide (PubChem CID 112990704) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-N-butylacetamide.
| Compound Name | 2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-N-butylacetamide |
|---|---|
| PubChem CID | 112990704 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonylamino]-N-butylacetamide |
| SMILES | CCCCNC(=O)CNS(=O)(=O)c1ccc2c(c1)CCN2C(C)=O |
| InChI | InChI=1S/C16H23N3O4S/c1-3-4-8-17-16(21)11-18-24(22,23)14-5-6-15-13(10-14)7-9-19(15)12(2)20/h5-6,10,18H,3-4,7-9,11H2,1-2H3,(H,17,21) |
| InChIKey | MGBSIPLVWIVFSI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|