C13H18N2O5S — CID 66178167
1-acetyl-N-(2,3-dihydroxypropyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 66178167) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-acetyl-N-(2,3-dihydroxypropyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-(2,3-dihydroxypropyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 66178167 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-acetyl-N-(2,3-dihydroxypropyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)NCC(O)CO)ccc21 |
| InChI | InChI=1S/C13H18N2O5S/c1-9(17)15-5-4-10-6-12(2-3-13(10)15)21(19,20)14-7-11(18)8-16/h2-3,6,11,14,16,18H,4-5,7-8H2,1H3 |
| InChIKey | RVHZCQHGTDTDTA-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |