C20H28N2O5S — CID 20864290
4-[5-(cyclooctylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid (PubChem CID 20864290) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is 4-[5-(cyclooctylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[5-(cyclooctylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20864290 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-[5-(cyclooctylsulfamoyl)-2,3-dihydroindol-1-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N1CCc2cc(S(=O)(=O)NC3CCCCCCC3)ccc21 |
| InChI | InChI=1S/C20H28N2O5S/c23-19(10-11-20(24)25)22-13-12-15-14-17(8-9-18(15)22)28(26,27)21-16-6-4-2-1-3-5-7-16/h8-9,14,16,21H,1-7,10-13H2,(H,24,25) |
| InChIKey | DEYPXGYUDHWIRH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |