C16H23N3O3S — CID 53005237
5-(cyclohexylsulfamoyl)-N-methyl-2,3-dihydroindole-1-carboxamide (PubChem CID 53005237) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 5-(cyclohexylsulfamoyl)-N-methyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | 5-(cyclohexylsulfamoyl)-N-methyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 53005237 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 5-(cyclohexylsulfamoyl)-N-methyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CNC(=O)N1CCc2cc(S(=O)(=O)NC3CCCCC3)ccc21 |
| InChI | InChI=1S/C16H23N3O3S/c1-17-16(20)19-10-9-12-11-14(7-8-15(12)19)23(21,22)18-13-5-3-2-4-6-13/h7-8,11,13,18H,2-6,9-10H2,1H3,(H,17,20) |
| InChIKey | WZBRLEMBZMWNDK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |