C24H29N3O3S — CID 19164497
N-cyclopentyl-1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 19164497) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-cyclopentyl-1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-cyclopentyl-1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 19164497 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-cyclopentyl-1-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enoyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CN(C)c1ccc(/C=C/C(=O)N2CCc3cc(S(=O)(=O)NC4CCCC4)ccc32)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-26(2)21-10-7-18(8-11-21)9-14-24(28)27-16-15-19-17-22(12-13-23(19)27)31(29,30)25-20-5-3-4-6-20/h7-14,17,20,25H,3-6,15-16H2,1-2H3/b14-9+ |
| InChIKey | KVHDSCIZTDOLNT-NTEUORMPSA-N |
| XLogP | 3.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|