C16H22N2O4S — CID 19164498
N-cyclopentyl-1-(2-methoxyacetyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 19164498) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-cyclopentyl-1-(2-methoxyacetyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-cyclopentyl-1-(2-methoxyacetyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 19164498 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-cyclopentyl-1-(2-methoxyacetyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | COCC(=O)N1CCc2cc(S(=O)(=O)NC3CCCC3)ccc21 |
| InChI | InChI=1S/C16H22N2O4S/c1-22-11-16(19)18-9-8-12-10-14(6-7-15(12)18)23(20,21)17-13-4-2-3-5-13/h6-7,10,13,17H,2-5,8-9,11H2,1H3 |
| InChIKey | YEEXTAMPCRZCJJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |