C16H26N2O3SSi — CID 166596719
1-acetyl-N-[tert-butyl(dimethyl)silyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 166596719) has the molecular formula C16H26N2O3SSi and a molecular weight of 354.55 g/mol. Its IUPAC name is 1-acetyl-N-[tert-butyl(dimethyl)silyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-[tert-butyl(dimethyl)silyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 166596719 |
| Molecular Formula | C16H26N2O3SSi |
| Molecular Weight | 354.55 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-acetyl-N-[tert-butyl(dimethyl)silyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)N[Si](C)(C)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C16H26N2O3SSi/c1-12(19)18-10-9-13-11-14(7-8-15(13)18)22(20,21)17-23(5,6)16(2,3)4/h7-8,11,17H,9-10H2,1-6H3 |
| InChIKey | AWIIHGSPVKXAIZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|