C17H16N2O5S — CID 26527621
(2-carbamoylphenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate (PubChem CID 26527621) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is (2-carbamoylphenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate.
| Compound Name | (2-carbamoylphenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
|---|---|
| PubChem CID | 26527621 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (2-carbamoylphenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)Oc3ccccc3C(N)=O)ccc21 |
| InChI | InChI=1S/C17H16N2O5S/c1-11(20)19-9-8-12-10-13(6-7-15(12)19)25(22,23)24-16-5-3-2-4-14(16)17(18)21/h2-7,10H,8-9H2,1H3,(H2,18,21) |
| InChIKey | DHGLXNQGQYUAPS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|