C16H14FNO4S — CID 51544824
(3-fluorophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate (PubChem CID 51544824) has the molecular formula C16H14FNO4S and a molecular weight of 335.36 g/mol. Its IUPAC name is (3-fluorophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate.
| Compound Name | (3-fluorophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
|---|---|
| PubChem CID | 51544824 |
| Molecular Formula | C16H14FNO4S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (3-fluorophenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)Oc3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C16H14FNO4S/c1-11(19)18-8-7-12-9-15(5-6-16(12)18)23(20,21)22-14-4-2-3-13(17)10-14/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | DHHBQMWARUXLMB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|