C22H19NO4S — CID 26526977
(2-phenylphenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate (PubChem CID 26526977) has the molecular formula C22H19NO4S and a molecular weight of 393.46 g/mol. Its IUPAC name is (2-phenylphenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate.
| Compound Name | (2-phenylphenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
|---|---|
| PubChem CID | 26526977 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (2-phenylphenyl) 1-acetyl-2,3-dihydroindole-5-sulfonate |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)Oc3ccccc3-c3ccccc3)ccc21 |
| InChI | InChI=1S/C22H19NO4S/c1-16(24)23-14-13-18-15-19(11-12-21(18)23)28(25,26)27-22-10-6-5-9-20(22)17-7-3-2-4-8-17/h2-12,15H,13-14H2,1H3 |
| InChIKey | LGCWARVVLZDEPM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|