C23H20N2O5S — CID 55448774
[2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-phenylbenzoate (PubChem CID 55448774) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-phenylbenzoate.
| Compound Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 55448774 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-phenylbenzoate |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)COC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H20N2O5S/c24-31(28,29)18-10-11-21-17(14-18)12-13-25(21)22(26)15-30-23(27)20-9-5-4-8-19(20)16-6-2-1-3-7-16/h1-11,14H,12-13,15H2,(H2,24,28,29) |
| InChIKey | SIPCUROTYPGBGE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |