C21H18N2O5S — CID 27310904
[2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] naphthalene-2-carboxylate (PubChem CID 27310904) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] naphthalene-2-carboxylate.
| Compound Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 27310904 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] naphthalene-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)COC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18N2O5S/c22-29(26,27)18-7-8-19-16(12-18)9-10-23(19)20(24)13-28-21(25)17-6-5-14-3-1-2-4-15(14)11-17/h1-8,11-12H,9-10,13H2,(H2,22,26,27) |
| InChIKey | HZCSJYPOXSOPOX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |