C17H15IN2O5S — CID 46645204
[2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-iodobenzoate (PubChem CID 46645204) has the molecular formula C17H15IN2O5S and a molecular weight of 486.29 g/mol. Its IUPAC name is [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-iodobenzoate.
| Compound Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 46645204 |
| Molecular Formula | C17H15IN2O5S |
| Molecular Weight | 486.29 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-iodobenzoate |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)COC(=O)c1ccccc1I |
| InChI | InChI=1S/C17H15IN2O5S/c18-14-4-2-1-3-13(14)17(22)25-10-16(21)20-8-7-11-9-12(26(19,23)24)5-6-15(11)20/h1-6,9H,7-8,10H2,(H2,19,23,24) |
| InChIKey | DUXAXINQKBWTAI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|