C12H14N2O3S — CID 62678193
1-but-3-enoyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 62678193) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-but-3-enoyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-but-3-enoyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 62678193 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-but-3-enoyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | C=CCC(=O)N1CCc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C12H14N2O3S/c1-2-3-12(15)14-7-6-9-8-10(18(13,16)17)4-5-11(9)14/h2,4-5,8H,1,3,6-7H2,(H2,13,16,17) |
| InChIKey | LIPZRCBVEKQIRJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|