C21H24N4O4S — CID 18286340
1-[2-(4-benzoylpiperazin-1-yl)acetyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 18286340) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-[2-(4-benzoylpiperazin-1-yl)acetyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[2-(4-benzoylpiperazin-1-yl)acetyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 18286340 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-[2-(4-benzoylpiperazin-1-yl)acetyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)CN1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N4O4S/c22-30(28,29)18-6-7-19-17(14-18)8-9-25(19)20(26)15-23-10-12-24(13-11-23)21(27)16-4-2-1-3-5-16/h1-7,14H,8-13,15H2,(H2,22,28,29) |
| InChIKey | FIBBRLVQRHAHSY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |