C16H23N3O3S — CID 31539906
1-[2-[(3R)-3-methylpiperidin-1-yl]acetyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 31539906) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-[2-[(3R)-3-methylpiperidin-1-yl]acetyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[2-[(3R)-3-methylpiperidin-1-yl]acetyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 31539906 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-[2-[(3R)-3-methylpiperidin-1-yl]acetyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | C[C@@H]1CCCN(CC(=O)N2CCc3cc(S(N)(=O)=O)ccc32)C1 |
| InChI | InChI=1S/C16H23N3O3S/c1-12-3-2-7-18(10-12)11-16(20)19-8-6-13-9-14(23(17,21)22)4-5-15(13)19/h4-5,9,12H,2-3,6-8,10-11H2,1H3,(H2,17,21,22)/t12-/m1/s1 |
| InChIKey | VELPQSSFJZIMBT-GFCCVEGCSA-N |
| XLogP | 0.95 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |