C16H16N2O3S2 — CID 71060712
1-(2-phenylsulfanylacetyl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 71060712) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-(2-phenylsulfanylacetyl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-(2-phenylsulfanylacetyl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 71060712 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 1-(2-phenylsulfanylacetyl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C16H16N2O3S2/c17-23(20,21)14-6-7-15-12(10-14)8-9-18(15)16(19)11-22-13-4-2-1-3-5-13/h1-7,10H,8-9,11H2,(H2,17,20,21) |
| InChIKey | WHSMDZAMNNAPIO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |