C16H14Cl2N2O3S2 — CID 24526881
1-[2-(2,5-dichlorophenyl)sulfanylacetyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 24526881) has the molecular formula C16H14Cl2N2O3S2 and a molecular weight of 417.34 g/mol. Its IUPAC name is 1-[2-(2,5-dichlorophenyl)sulfanylacetyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[2-(2,5-dichlorophenyl)sulfanylacetyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 24526881 |
| Molecular Formula | C16H14Cl2N2O3S2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | 1-[2-(2,5-dichlorophenyl)sulfanylacetyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H14Cl2N2O3S2/c17-11-1-3-13(18)15(8-11)24-9-16(21)20-6-5-10-7-12(25(19,22)23)2-4-14(10)20/h1-4,7-8H,5-6,9H2,(H2,19,22,23) |
| InChIKey | ALIPLWDIJKWNQY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |