C16H13Cl3N2O4S — CID 27316873
1-[2-(2,4,5-trichlorophenoxy)acetyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 27316873) has the molecular formula C16H13Cl3N2O4S and a molecular weight of 435.72 g/mol. Its IUPAC name is 1-[2-(2,4,5-trichlorophenoxy)acetyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[2-(2,4,5-trichlorophenoxy)acetyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 27316873 |
| Molecular Formula | C16H13Cl3N2O4S |
| Molecular Weight | 435.72 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | 1-[2-(2,4,5-trichlorophenoxy)acetyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl3N2O4S/c17-11-6-13(19)15(7-12(11)18)25-8-16(22)21-4-3-9-5-10(26(20,23)24)1-2-14(9)21/h1-2,5-7H,3-4,8H2,(H2,20,23,24) |
| InChIKey | KWNRSMOPMRATHM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|