C22H20N2O5S — CID 27309776
[2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-naphthalen-1-ylacetate (PubChem CID 27309776) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 27309776 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 2-naphthalen-1-ylacetate |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)COC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H20N2O5S/c23-30(27,28)18-8-9-20-17(12-18)10-11-24(20)21(25)14-29-22(26)13-16-6-3-5-15-4-1-2-7-19(15)16/h1-9,12H,10-11,13-14H2,(H2,23,27,28) |
| InChIKey | WDZYAHUFMFUJPI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |