C20H20N4O7S2 — CID 166196741
[2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 166196741) has the molecular formula C20H20N4O7S2 and a molecular weight of 492.54 g/mol. Its IUPAC name is [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 166196741 |
| Molecular Formula | C20H20N4O7S2 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | [2-oxo-2-(5-sulfamoyl-2,3-dihydroindol-1-yl)ethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CCN2C(=O)COC(=O)CC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C20H20N4O7S2/c21-32(27,28)14-5-6-16-13(11-14)8-10-24(16)18(25)12-31-19(26)7-9-22-20-15-3-1-2-4-17(15)33(29,30)23-20/h1-6,11H,7-10,12H2,(H,22,23)(H2,21,27,28) |
| InChIKey | FHOZHERXPRLYQG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 165.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|