C18H14F2N2O5S — CID 135583023
[2-(2,5-difluorophenyl)-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135583023) has the molecular formula C18H14F2N2O5S and a molecular weight of 408.38 g/mol. Its IUPAC name is [2-(2,5-difluorophenyl)-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135583023 |
| Molecular Formula | C18H14F2N2O5S |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [2-(2,5-difluorophenyl)-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)OCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H14F2N2O5S/c19-11-5-6-14(20)13(9-11)15(23)10-27-17(24)7-8-21-18-12-3-1-2-4-16(12)28(25,26)22-18/h1-6,9H,7-8,10H2,(H,21,22) |
| InChIKey | BFCTVASFRHQINO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|