C18H17FN4O4S — CID 135673913
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide (PubChem CID 135673913) has the molecular formula C18H17FN4O4S and a molecular weight of 404.42 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 135673913 |
| Molecular Formula | C18H17FN4O4S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N'-[2-(4-fluorophenyl)acetyl]propanehydrazide |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)NNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN4O4S/c19-13-7-5-12(6-8-13)11-17(25)22-21-16(24)9-10-20-18-14-3-1-2-4-15(14)28(26,27)23-18/h1-8H,9-11H2,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | ODHWBRQQKQJGQO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|