C17H18N4O5S — CID 135900282
N-[2-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoylamino]ethyl]furan-2-carboxamide (PubChem CID 135900282) has the molecular formula C17H18N4O5S and a molecular weight of 390.42 g/mol. Its IUPAC name is N-[2-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 135900282 |
| Molecular Formula | C17H18N4O5S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-[2-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoylamino]ethyl]furan-2-carboxamide |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C17H18N4O5S/c22-15(18-9-10-20-17(23)13-5-3-11-26-13)7-8-19-16-12-4-1-2-6-14(12)27(24,25)21-16/h1-6,11H,7-10H2,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | VAGTXNYZUSSSMV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|