C16H13N3O7S — CID 135903594
[2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate (PubChem CID 135903594) has the molecular formula C16H13N3O7S and a molecular weight of 391.36 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate.
| Compound Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
|---|---|
| PubChem CID | 135903594 |
| Molecular Formula | C16H13N3O7S |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
| SMILES | O=C(COC(=O)C/N=C1\NS(=O)(=O)c2ccccc21)NC(=O)c1ccco1 |
| InChI | InChI=1S/C16H13N3O7S/c20-13(18-16(22)11-5-3-7-25-11)9-26-14(21)8-17-15-10-4-1-2-6-12(10)27(23,24)19-15/h1-7H,8-9H2,(H,17,19)(H,18,20,22) |
| InChIKey | NQSXWTIRIPSCSC-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|