C18H15FN2O6S — CID 135766380
[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate (PubChem CID 135766380) has the molecular formula C18H15FN2O6S and a molecular weight of 406.39 g/mol. Its IUPAC name is [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate.
| Compound Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
|---|---|
| PubChem CID | 135766380 |
| Molecular Formula | C18H15FN2O6S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
| SMILES | COc1ccc(F)cc1C(=O)COC(=O)C/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H15FN2O6S/c1-26-15-7-6-11(19)8-13(15)14(22)10-27-17(23)9-20-18-12-4-2-3-5-16(12)28(24,25)21-18/h2-8H,9-10H2,1H3,(H,20,21) |
| InChIKey | LCXKEOZXAOAXNP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|