C15H14N4O5S — CID 135447933
(4-amino-3-cyano-2-oxopent-3-enyl) 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate (PubChem CID 135447933) has the molecular formula C15H14N4O5S and a molecular weight of 362.37 g/mol. Its IUPAC name is (4-amino-3-cyano-2-oxopent-3-enyl) 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate.
| Compound Name | (4-amino-3-cyano-2-oxopent-3-enyl) 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
|---|---|
| PubChem CID | 135447933 |
| Molecular Formula | C15H14N4O5S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (4-amino-3-cyano-2-oxopent-3-enyl) 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
| SMILES | CC(N)=C(C#N)C(=O)COC(=O)C/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C15H14N4O5S/c1-9(17)11(6-16)12(20)8-24-14(21)7-18-15-10-4-2-3-5-13(10)25(22,23)19-15/h2-5H,7-8,17H2,1H3,(H,18,19) |
| InChIKey | XJRWSZHBKXFRFZ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 151.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|