C18H20N4O5S — CID 135766493
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate (PubChem CID 135766493) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
|---|---|
| PubChem CID | 135766493 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
| SMILES | N#CC1(NC(=O)COC(=O)C/N=C2\NS(=O)(=O)c3ccccc32)CCCCC1 |
| InChI | InChI=1S/C18H20N4O5S/c19-12-18(8-4-1-5-9-18)21-15(23)11-27-16(24)10-20-17-13-6-2-3-7-14(13)28(25,26)22-17/h2-3,6-7H,1,4-5,8-11H2,(H,20,22)(H,21,23) |
| InChIKey | RHDXUZZPYLTBSF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 137.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|