C21H21N3O5S — CID 135737840
[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate (PubChem CID 135737840) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate.
| Compound Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
|---|---|
| PubChem CID | 135737840 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
| SMILES | O=C(COC(=O)C/N=C1\NS(=O)(=O)c2ccccc21)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C21H21N3O5S/c25-19(23-17-10-5-7-14-6-1-2-8-15(14)17)13-29-20(26)12-22-21-16-9-3-4-11-18(16)30(27,28)24-21/h1-4,6,8-9,11,17H,5,7,10,12-13H2,(H,22,24)(H,23,25)/t17-/m1/s1 |
| InChIKey | ZBMYMJUSFVRKIO-QGZVFWFLSA-N |
| XLogP | 1.46 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|