C19H23N3O3S — CID 135954932
N-(1-adamantyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide (PubChem CID 135954932) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide.
| Compound Name | N-(1-adamantyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 135954932 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-(1-adamantyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H23N3O3S/c23-17(21-19-8-12-5-13(9-19)7-14(6-12)10-19)11-20-18-15-3-1-2-4-16(15)26(24,25)22-18/h1-4,12-14H,5-11H2,(H,20,22)(H,21,23) |
| InChIKey | KRCUGYPXPCRWIG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|