C14H16N4O4S — CID 136790588
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(3R)-2-oxopiperidin-3-yl]acetamide (PubChem CID 136790588) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(3R)-2-oxopiperidin-3-yl]acetamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(3R)-2-oxopiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 136790588 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(3R)-2-oxopiperidin-3-yl]acetamide |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)N[C@@H]1CCCNC1=O |
| InChI | InChI=1S/C14H16N4O4S/c19-12(17-10-5-3-7-15-14(10)20)8-16-13-9-4-1-2-6-11(9)23(21,22)18-13/h1-2,4,6,10H,3,5,7-8H2,(H,15,20)(H,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | YGKIBRHPFOQMBL-SNVBAGLBSA-N |
| XLogP | -0.88 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|